C27H38O10 — CID 163041568
[(1R,2R,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] propanoate (PubChem CID 163041568) has the molecular formula C27H38O10 and a molecular weight of 522.59 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] propanoate.
| Compound Name | [(1R,2R,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] propanoate |
|---|---|
| PubChem CID | 163041568 |
| Molecular Formula | C27H38O10 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [(1R,2R,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C[C@H](OC(C)=O)[C@@]2(C)[C@H]([C@H]1C)[C@@H](O)[C@]13O[C@@]1(C)C(=O)O[C@H]3/C=C(/C)CC[C@H]2OC(C)=O |
| InChI | InChI=1S/C27H38O10/c1-8-21(30)35-17-12-19(34-16(5)29)25(6)18(33-15(4)28)10-9-13(2)11-20-27(23(31)22(25)14(17)3)26(7,37-27)24(32)36-20/h11,14,17-20,22-23,31H,8-10,12H2,1-7H3/b13-11-/t14-,17-,18+,19-,20-,22+,23+,25-,26-,27-/m0/s1 |
| InChIKey | QBPHCUGJAMMXSE-FYVFDOMWSA-N |
| XLogP | 2.39 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|