C22H32O8 — CID 20704696
[(1R,2R,3S,4R,5S,7S,8S,9S,12Z,14S,17S)-2,5,9-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate (PubChem CID 20704696) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S,7S,8S,9S,12Z,14S,17S)-2,5,9-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate.
| Compound Name | [(1R,2R,3S,4R,5S,7S,8S,9S,12Z,14S,17S)-2,5,9-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate |
|---|---|
| PubChem CID | 20704696 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(1R,2R,3S,4R,5S,7S,8S,9S,12Z,14S,17S)-2,5,9-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@H](C)[C@@H]2[C@@H](O)[C@]34O[C@]3(C)C(=O)O[C@H]4/C=C(/C)CC[C@H](O)[C@]21C |
| InChI | InChI=1S/C22H32O8/c1-10-6-7-14(25)20(4)15(28-12(3)23)9-13(24)11(2)17(20)18(26)22-16(8-10)29-19(27)21(22,5)30-22/h8,11,13-18,24-26H,6-7,9H2,1-5H3/b10-8-/t11-,13-,14-,15-,16-,17+,18+,20-,21+,22-/m0/s1 |
| InChIKey | YTDJCQGTYGTQKA-QJYBCKFESA-N |
| XLogP | 0.86 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|