C26H36O12 — CID 177452965
[(1S,2R,3R,4R,5R,7R,8S,9R,11S,12E,14R,17S)-7,9-diacetyloxy-2,4,5-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-11-yl] acetate (PubChem CID 177452965) has the molecular formula C26H36O12 and a molecular weight of 540.56 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5R,7R,8S,9R,11S,12E,14R,17S)-7,9-diacetyloxy-2,4,5-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-11-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,5R,7R,8S,9R,11S,12E,14R,17S)-7,9-diacetyloxy-2,4,5-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-11-yl] acetate |
|---|---|
| PubChem CID | 177452965 |
| Molecular Formula | C26H36O12 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | [(1S,2R,3R,4R,5R,7R,8S,9R,11S,12E,14R,17S)-7,9-diacetyloxy-2,4,5-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC(C)=O)[C@@]2(C)[C@H]([C@@H](O)[C@@]34O[C@]3(C)C(=O)O[C@@H]4/C=C\1C)[C@@](C)(O)[C@H](O)C[C@H]2OC(C)=O |
| InChI | InChI=1S/C26H36O12/c1-11-8-19-26(25(7,38-26)22(32)37-19)21(31)20-23(5,17(35-13(3)28)9-15(11)34-12(2)27)18(36-14(4)29)10-16(30)24(20,6)33/h8,15-21,30-31,33H,9-10H2,1-7H3/b11-8-/t15-,16+,17+,18+,19+,20-,21+,23+,24-,25+,26+/m0/s1 |
| InChIKey | FVRBJFJBALEKEF-KCMPMLKZSA-N |
| XLogP | 0.08 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|