C30H42O13 — CID 162867874
(2,7,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl) butanoate (PubChem CID 162867874) has the molecular formula C30H42O13 and a molecular weight of 610.65 g/mol. Its IUPAC name is (2,7,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl) butanoate.
| Compound Name | (2,7,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl) butanoate |
|---|---|
| PubChem CID | 162867874 |
| Molecular Formula | C30H42O13 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | (2,7,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl) butanoate |
| SMILES | CCCC(=O)OC1CC(OC(C)=O)C2(C)C(OC(C)=O)CC(O)C(C)=CC3OC(=O)C4(C)OC34C(OC(C)=O)C2C1(C)O |
| InChI | InChI=1S/C30H42O13/c1-9-10-23(35)41-21-13-20(39-16(4)32)27(6)19(38-15(3)31)12-18(34)14(2)11-22-30(29(8,43-30)26(36)42-22)25(40-17(5)33)24(27)28(21,7)37/h11,18-22,24-25,34,37H,9-10,12-13H2,1-8H3 |
| InChIKey | QQBDWJIBXKDRPZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|