C28H38O11 — CID 163191648
[(1S,2S,3R,4R,5R,8S,9S,11R,14S,17R)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate (PubChem CID 163191648) has the molecular formula C28H38O11 and a molecular weight of 550.60 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,8S,9S,11R,14S,17R)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate.
| Compound Name | [(1S,2S,3R,4R,5R,8S,9S,11R,14S,17R)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate |
|---|---|
| PubChem CID | 163191648 |
| Molecular Formula | C28H38O11 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(1S,2S,3R,4R,5R,8S,9S,11R,14S,17R)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)C=C[C@@H](O)[C@](C)(O)[C@H]2[C@H](OC(C)=O)[C@]23O[C@@]2(C)C(=O)O[C@H]3C=C1C |
| InChI | InChI=1S/C28H38O11/c1-8-9-21(32)37-17-13-19(35-15(3)29)25(5)11-10-18(31)26(6,34)22(25)23(36-16(4)30)28-20(12-14(17)2)38-24(33)27(28,7)39-28/h10-12,17-20,22-23,31,34H,8-9,13H2,1-7H3/t17-,18-,19+,20+,22+,23+,25-,26+,27+,28+/m1/s1 |
| InChIKey | HAQVZQHBSNIEQX-RINJOUJYSA-N |
| XLogP | 1.67 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|