C34H48O13 — CID 163103327
(2,5,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) octanoate (PubChem CID 163103327) has the molecular formula C34H48O13 and a molecular weight of 664.74 g/mol. Its IUPAC name is (2,5,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) octanoate.
| Compound Name | (2,5,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) octanoate |
|---|---|
| PubChem CID | 163103327 |
| Molecular Formula | C34H48O13 |
| Molecular Weight | 664.74 g/mol |
| Exact Mass | 664.31 |
| IUPAC Name | (2,5,9-triacetyloxy-4,11-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC1(O)CC(OC(C)=O)C2(C)C=CC(OC(C)=O)C(C)(O)C2C(OC(C)=O)C23OC2(C)C(=O)OC3C=C1C |
| InChI | InChI=1S/C34H48O13/c1-9-10-11-12-13-14-26(38)46-33(41)18-25(43-21(4)36)30(6)16-15-23(42-20(3)35)31(7,40)27(30)28(44-22(5)37)34-24(17-19(33)2)45-29(39)32(34,8)47-34/h15-17,23-25,27-28,40-41H,9-14,18H2,1-8H3 |
| InChIKey | ADXUQEXAZJOSIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|