C27H36O11 — CID 163113099
(5,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) propanoate (PubChem CID 163113099) has the molecular formula C27H36O11 and a molecular weight of 536.57 g/mol. Its IUPAC name is (5,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) propanoate.
| Compound Name | (5,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) propanoate |
|---|---|
| PubChem CID | 163113099 |
| Molecular Formula | C27H36O11 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (5,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl) propanoate |
| SMILES | CCC(=O)OC1CC(OC(C)=O)C2(C)C=CC(OC(C)=O)C(C)(O)C2C(O)C23OC2(C)C(=O)OC3C=C1C |
| InChI | InChI=1S/C27H36O11/c1-8-20(30)36-16-12-18(35-15(4)29)24(5)10-9-17(34-14(3)28)25(6,33)21(24)22(31)27-19(11-13(16)2)37-23(32)26(27,7)38-27/h9-11,16-19,21-22,31,33H,8,12H2,1-7H3 |
| InChIKey | RMFPBRDGEISAFY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|