C30H40O13 — CID 177414022
[(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10-triacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate (PubChem CID 177414022) has the molecular formula C30H40O13 and a molecular weight of 608.64 g/mol. Its IUPAC name is [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10-triacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate.
| Compound Name | [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10-triacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate |
|---|---|
| PubChem CID | 177414022 |
| Molecular Formula | C30H40O13 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10-triacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] butanoate |
| SMILES | CCCC(=O)OC1/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@]23C(OC(C)=O)[C@H]2[C@](C)(O)[C@H](O)C=C[C@]2(C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H40O13/c1-9-10-20(35)42-21-14(2)13-19-30(29(8,43-30)26(36)41-19)25(40-17(5)33)23-27(6,12-11-18(34)28(23,7)37)24(39-16(4)32)22(21)38-15(3)31/h11-13,18-19,21-25,34,37H,9-10H2,1-8H3/b14-13-/t18-,19+,21?,22-,23-,24+,25?,27+,28-,29+,30+/m1/s1 |
| InChIKey | DVWNRUWDZLVEMY-RJXZEEDLSA-N |
| XLogP | 1.21 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|