C34H46O13 — CID 73059424
(2,7,9-triacetyloxy-11-butanoyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl) butanoate (PubChem CID 73059424) has the molecular formula C34H46O13 and a molecular weight of 662.73 g/mol. Its IUPAC name is (2,7,9-triacetyloxy-11-butanoyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl) butanoate.
| Compound Name | (2,7,9-triacetyloxy-11-butanoyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl) butanoate |
|---|---|
| PubChem CID | 73059424 |
| Molecular Formula | C34H46O13 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | (2,7,9-triacetyloxy-11-butanoyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl) butanoate |
| SMILES | CCCC(=O)OC1C(C)=CC2OC(=O)C3(C)OC23C(OC(C)=O)C2C(C)=CCC(OC(C)=O)C2(C)C(OC(C)=O)C1OC(=O)CCC |
| InChI | InChI=1S/C34H46O13/c1-10-12-24(38)45-27-18(4)16-23-34(33(9,47-34)31(40)44-23)29(42-20(6)36)26-17(3)14-15-22(41-19(5)35)32(26,8)30(43-21(7)37)28(27)46-25(39)13-11-2/h14,16,22-23,26-30H,10-13,15H2,1-9H3 |
| InChIKey | GBCBINOVRJNUFM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 170.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|