C28H40O9 — CID 177489070
[(1S,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate (PubChem CID 177489070) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(1S,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate.
| Compound Name | [(1S,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate |
|---|---|
| PubChem CID | 177489070 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(1S,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)C(OC(C)=O)[C@H]2C(C)=CC[C@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C28H40O9/c1-8-9-23(31)36-21-12-10-15(2)14-22-28(33,17(4)26(32)37-22)25(35-19(6)30)24-16(3)11-13-20(27(21,24)7)34-18(5)29/h11,14,17,20-22,24-25,33H,8-10,12-13H2,1-7H3/b15-14-/t17-,20-,21+,22-,24+,25?,27+,28-/m0/s1 |
| InChIKey | WUAAFCGTSYYMLQ-SCGCRFMBSA-N |
| XLogP | 3.57 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|