C31H44O11 — CID 162650807
[(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] 3-methylbutanoate (PubChem CID 162650807) has the molecular formula C31H44O11 and a molecular weight of 592.68 g/mol. Its IUPAC name is [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] 3-methylbutanoate.
| Compound Name | [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162650807 |
| Molecular Formula | C31H44O11 |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] 3-methylbutanoate |
| SMILES | C=C1CC[C@H](OC(=O)CC(C)C)[C@]2(C)[C@@H](OC(C)=O)C[C@@H](OC(C)=O)/C(C)=C\[C@@H]3OC(=O)[C@H](C)[C@@]3(O)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C31H44O11/c1-15(2)12-26(35)41-23-11-10-16(3)27-28(40-21(8)34)31(37)18(5)29(36)42-25(31)13-17(4)22(38-19(6)32)14-24(30(23,27)9)39-20(7)33/h13,15,18,22-25,27-28,37H,3,10-12,14H2,1-2,4-9H3/b17-13-/t18-,22+,23-,24-,25-,27+,28-,30+,31-/m0/s1 |
| InChIKey | YVALZDBXJPURBZ-WJKRCADUSA-N |
| XLogP | 3.35 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|