C32H44O13 — CID 73114238
(2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl) 3-acetyloxybutanoate (PubChem CID 73114238) has the molecular formula C32H44O13 and a molecular weight of 636.69 g/mol. Its IUPAC name is (2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl) 3-acetyloxybutanoate.
| Compound Name | (2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl) 3-acetyloxybutanoate |
|---|---|
| PubChem CID | 73114238 |
| Molecular Formula | C32H44O13 |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | (2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl) 3-acetyloxybutanoate |
| SMILES | CC(=O)OC(C)CC(=O)OC1CC(OC(C)=O)C2(C)C(OC(C)=O)CC=C(C)C2C(OC(C)=O)C2(O)C(C=C1C)OC(=O)C2C |
| InChI | InChI=1S/C32H44O13/c1-15-10-11-24(41-20(6)34)31(9)25(42-21(7)35)14-23(44-27(37)13-17(3)40-19(5)33)16(2)12-26-32(39,18(4)30(38)45-26)29(28(15)31)43-22(8)36/h10,12,17-18,23-26,28-29,39H,11,13-14H2,1-9H3 |
| InChIKey | NBKAWRPDAYLKJU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|