C30H40O14 — CID 10675410
[(1S,2R,3S,4R,7S,8E,10Z,12R,13R,14S,16R,17S)-2,12,14,16-tetraacetyloxy-3,17-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-dien-9-yl]methyl acetate (PubChem CID 10675410) has the molecular formula C30H40O14 and a molecular weight of 624.64 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8E,10Z,12R,13R,14S,16R,17S)-2,12,14,16-tetraacetyloxy-3,17-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-dien-9-yl]methyl acetate.
| Compound Name | [(1S,2R,3S,4R,7S,8E,10Z,12R,13R,14S,16R,17S)-2,12,14,16-tetraacetyloxy-3,17-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-dien-9-yl]methyl acetate |
|---|---|
| PubChem CID | 10675410 |
| Molecular Formula | C30H40O14 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8E,10Z,12R,13R,14S,16R,17S)-2,12,14,16-tetraacetyloxy-3,17-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-dien-9-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C/[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@H](OC(C)=O)[C@H]2[C@](C)(O)[C@H](OC(C)=O)C[C@H](OC(C)=O)[C@]2(C)[C@H](OC(C)=O)/C=C\1 |
| InChI | InChI=1S/C30H40O14/c1-14-27(36)44-24-11-20(13-39-15(2)31)9-10-21(40-16(3)32)28(7)22(41-17(4)33)12-23(42-18(5)34)29(8,37)25(28)26(30(14,24)38)43-19(6)35/h9-11,14,21-26,37-38H,12-13H2,1-8H3/b10-9-,20-11+/t14-,21+,22-,23+,24-,25+,26+,28-,29+,30-/m0/s1 |
| InChIKey | HTVWHCFKRMSRQO-RGYUEPMCSA-N |
| XLogP | 0.84 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|