C39H54O17 — CID 72670130
[2-oxo-2-[2,14,15-triacetyloxy-3-hydroxy-9-(methoxymethyl)-4,13-dimethyl-16-(3-methylbutanoyloxy)-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxyethyl] 3-methylbutanoate (PubChem CID 72670130) has the molecular formula C39H54O17 and a molecular weight of 794.84 g/mol. Its IUPAC name is [2-oxo-2-[2,14,15-triacetyloxy-3-hydroxy-9-(methoxymethyl)-4,13-dimethyl-16-(3-methylbutanoyloxy)-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxyethyl] 3-methylbutanoate.
| Compound Name | [2-oxo-2-[2,14,15-triacetyloxy-3-hydroxy-9-(methoxymethyl)-4,13-dimethyl-16-(3-methylbutanoyloxy)-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxyethyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 72670130 |
| Molecular Formula | C39H54O17 |
| Molecular Weight | 794.84 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | [2-oxo-2-[2,14,15-triacetyloxy-3-hydroxy-9-(methoxymethyl)-4,13-dimethyl-16-(3-methylbutanoyloxy)-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxyethyl] 3-methylbutanoate |
| SMILES | COCC1=CC2OC(=O)C(C)C2(O)C(OC(C)=O)C2C3(CO3)C(OC(=O)CC(C)C)C(OC(C)=O)C(OC(C)=O)C2(C)C(OC(=O)COC(=O)CC(C)C)C=C1 |
| InChI | InChI=1S/C39H54O17/c1-19(2)13-28(43)49-17-30(45)54-26-12-11-25(16-48-10)15-27-39(47,21(5)36(46)55-27)35(53-24(8)42)32-37(26,9)33(52-23(7)41)31(51-22(6)40)34(38(32)18-50-38)56-29(44)14-20(3)4/h11-12,15,19-21,26-27,31-35,47H,13-14,16-18H2,1-10H3 |
| InChIKey | MFWAFHKUSPXNEJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 226.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|