C34H46O16 — CID 162969446
[2,14,16-triacetyloxy-3-hydroxy-12-(2-hydroxyacetyl)oxy-9-(methoxymethyl)-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-15-yl] 3-methylbutanoate (PubChem CID 162969446) has the molecular formula C34H46O16 and a molecular weight of 710.73 g/mol. Its IUPAC name is [2,14,16-triacetyloxy-3-hydroxy-12-(2-hydroxyacetyl)oxy-9-(methoxymethyl)-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-15-yl] 3-methylbutanoate.
| Compound Name | [2,14,16-triacetyloxy-3-hydroxy-12-(2-hydroxyacetyl)oxy-9-(methoxymethyl)-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-15-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162969446 |
| Molecular Formula | C34H46O16 |
| Molecular Weight | 710.73 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | [2,14,16-triacetyloxy-3-hydroxy-12-(2-hydroxyacetyl)oxy-9-(methoxymethyl)-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-15-yl] 3-methylbutanoate |
| SMILES | COCC1=CC2OC(=O)C(C)C2(O)C(OC(C)=O)C2C3(CO3)C(OC(C)=O)C(OC(=O)CC(C)C)C(OC(C)=O)C2(C)C(OC(=O)CO)C=C1 |
| InChI | InChI=1S/C34H46O16/c1-16(2)11-24(39)50-26-28(45-18(4)36)32(7)22(48-25(40)13-35)10-9-21(14-43-8)12-23-34(42,17(3)31(41)49-23)30(47-20(6)38)27(32)33(15-44-33)29(26)46-19(5)37/h9-10,12,16-17,22-23,26-30,35,42H,11,13-15H2,1-8H3 |
| InChIKey | CRRNBCTYJMZLTQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 220.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.73 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|