C33H44O14 — CID 163115147
[2-[2,14-diacetyloxy-9-(acetyloxymethyl)-3-hydroxy-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxy-2-oxoethyl] 3-methylbutanoate (PubChem CID 163115147) has the molecular formula C33H44O14 and a molecular weight of 664.70 g/mol. Its IUPAC name is [2-[2,14-diacetyloxy-9-(acetyloxymethyl)-3-hydroxy-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxy-2-oxoethyl] 3-methylbutanoate.
| Compound Name | [2-[2,14-diacetyloxy-9-(acetyloxymethyl)-3-hydroxy-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxy-2-oxoethyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163115147 |
| Molecular Formula | C33H44O14 |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | [2-[2,14-diacetyloxy-9-(acetyloxymethyl)-3-hydroxy-4,13-dimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadeca-8,10-diene-17,2'-oxirane]-12-yl]oxy-2-oxoethyl] 3-methylbutanoate |
| SMILES | CC(=O)OCC1=CC2OC(=O)C(C)C2(O)C(OC(C)=O)C2C3(CCC(OC(C)=O)C2(C)C(OC(=O)COC(=O)CC(C)C)C=C1)CO3 |
| InChI | InChI=1S/C33H44O14/c1-17(2)12-26(37)42-15-27(38)46-23-9-8-22(14-41-19(4)34)13-25-33(40,18(3)30(39)47-25)29(45-21(6)36)28-31(23,7)24(44-20(5)35)10-11-32(28)16-43-32/h8-9,13,17-18,23-25,28-29,40H,10-12,14-16H2,1-7H3 |
| InChIKey | WZKUWNMWHWGQJH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 190.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|