C35H50O13 — CID 163033286
[2,14,15-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-12-(2-methylpropanoyloxy)-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-10-yl] 3-methylbutanoate (PubChem CID 163033286) has the molecular formula C35H50O13 and a molecular weight of 678.77 g/mol. Its IUPAC name is [2,14,15-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-12-(2-methylpropanoyloxy)-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-10-yl] 3-methylbutanoate.
| Compound Name | [2,14,15-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-12-(2-methylpropanoyloxy)-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-10-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163033286 |
| Molecular Formula | C35H50O13 |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | [2,14,15-triacetyloxy-3-hydroxy-4,9,13-trimethyl-17-methylidene-12-(2-methylpropanoyloxy)-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-10-yl] 3-methylbutanoate |
| SMILES | C=C1CC(OC(C)=O)C(OC(C)=O)C2(C)C(OC(=O)C(C)C)CC(OC(=O)CC(C)C)C(C)=CC3OC(=O)C(C)C3(O)C(OC(C)=O)C12 |
| InChI | InChI=1S/C35H50O13/c1-16(2)12-28(39)46-24-15-26(47-32(40)17(3)4)34(11)29(19(6)13-25(43-21(8)36)30(34)44-22(9)37)31(45-23(10)38)35(42)20(7)33(41)48-27(35)14-18(24)5/h14,16-17,20,24-27,29-31,42H,6,12-13,15H2,1-5,7-11H3 |
| InChIKey | GAGRCAKSDOJRKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|