C29H42O9 — CID 162800639
[(1S,2R,3S,4R,7S,8Z,12R,13S,16R,17R)-2,12-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-16-yl] pentanoate (PubChem CID 162800639) has the molecular formula C29H42O9 and a molecular weight of 534.65 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12R,13S,16R,17R)-2,12-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-16-yl] pentanoate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,16R,17R)-2,12-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-16-yl] pentanoate |
|---|---|
| PubChem CID | 162800639 |
| Molecular Formula | C29H42O9 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,16R,17R)-2,12-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-16-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@H]1C=C[C@@]2(C)[C@H]([C@H]1C)[C@@H](OC(C)=O)[C@@]1(O)[C@H](/C=C(/C)CC[C@H]2OC(C)=O)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C29H42O9/c1-8-9-10-24(32)37-21-13-14-28(7)22(35-19(5)30)12-11-16(2)15-23-29(34,18(4)27(33)38-23)26(36-20(6)31)25(28)17(21)3/h13-15,17-18,21-23,25-26,34H,8-12H2,1-7H3/b16-15-/t17-,18-,21+,22+,23-,25+,26+,28+,29-/m0/s1 |
| InChIKey | MQAGJESGSBFSRU-KNLBLNPRSA-N |
| XLogP | 3.81 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|