C22H34O8 — CID 10598511
[(1S,2R,3S,4R,7S,8Z,12S,13S,14S,17S)-3,12,14,17-tetrahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-2-yl] acetate (PubChem CID 10598511) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,17S)-3,12,14,17-tetrahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-2-yl] acetate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,17S)-3,12,14,17-tetrahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-2-yl] acetate |
|---|---|
| PubChem CID | 10598511 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,17S)-3,12,14,17-tetrahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@](C)([C@@H](O)CC/C(C)=C\[C@@H]3OC(=O)[C@H](C)[C@]31O)[C@@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C22H34O8/c1-11-6-7-14(24)21(5)15(25)8-9-20(4,27)17(21)18(29-13(3)23)22(28)12(2)19(26)30-16(22)10-11/h10,12,14-18,24-25,27-28H,6-9H2,1-5H3/b11-10-/t12-,14-,15-,16-,17-,18+,20-,21-,22-/m0/s1 |
| InChIKey | XKQLUUAHCWUFFQ-MFSPBOHPSA-N |
| XLogP | 0.84 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|