C24H32O10 — CID 163010389
[(1S,2S,3R,4R,7S,8Z,10E,12S,13S,14R,16S,17R,18R)-2-acetyloxy-3,12-dihydroxy-9-(hydroxymethyl)-4,13,18-trimethyl-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadeca-8,10-dien-17-yl] acetate (PubChem CID 163010389) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7S,8Z,10E,12S,13S,14R,16S,17R,18R)-2-acetyloxy-3,12-dihydroxy-9-(hydroxymethyl)-4,13,18-trimethyl-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadeca-8,10-dien-17-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7S,8Z,10E,12S,13S,14R,16S,17R,18R)-2-acetyloxy-3,12-dihydroxy-9-(hydroxymethyl)-4,13,18-trimethyl-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadeca-8,10-dien-17-yl] acetate |
|---|---|
| PubChem CID | 163010389 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [(1S,2S,3R,4R,7S,8Z,10E,12S,13S,14R,16S,17R,18R)-2-acetyloxy-3,12-dihydroxy-9-(hydroxymethyl)-4,13,18-trimethyl-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadeca-8,10-dien-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)[C@@H]2[C@H](OC(C)=O)[C@]3(O)[C@H](/C=C(CO)/C=C\[C@H](O)[C@@]2(C)[C@H]2O[C@@H]12)OC(=O)[C@@H]3C |
| InChI | InChI=1S/C24H32O10/c1-10-17-20(32-13(4)27)24(30)11(2)22(29)33-16(24)8-14(9-25)6-7-15(28)23(17,5)21-19(34-21)18(10)31-12(3)26/h6-8,10-11,15-21,25,28,30H,9H2,1-5H3/b7-6-,14-8-/t10-,11+,15+,16+,17-,18-,19+,20+,21+,23-,24-/m1/s1 |
| InChIKey | WVANZYSYMWBAHQ-FIZDTANGSA-N |
| XLogP | 0.03 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|