C30H44O11 — CID 163115874
[(1R,2S,3S,4R,5R,7S,8S,9S,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] hexanoate (PubChem CID 163115874) has the molecular formula C30H44O11 and a molecular weight of 580.67 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5R,7S,8S,9S,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] hexanoate.
| Compound Name | [(1R,2S,3S,4R,5R,7S,8S,9S,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] hexanoate |
|---|---|
| PubChem CID | 163115874 |
| Molecular Formula | C30H44O11 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | [(1R,2S,3S,4R,5R,7S,8S,9S,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1C[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)CC/C(C)=C\[C@@H]3OC(=O)[C@]4(C)O[C@]34[C@@H](O)[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C30H44O11/c1-8-9-10-11-23(33)39-21-15-20(38-18(4)32)27(5)19(37-17(3)31)13-12-16(2)14-22-30(25(34)24(27)28(21,6)36)29(7,41-30)26(35)40-22/h14,19-22,24-25,34,36H,8-13,15H2,1-7H3/b16-14-/t19-,20-,21+,22-,24+,25-,27-,28-,29-,30-/m0/s1 |
| InChIKey | YPAHSMNJUJGLKN-OPGVDRKNSA-N |
| XLogP | 2.67 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|