C28H40O11 — CID 162885077
[(1R,2R,3S,4R,5R,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] butanoate (PubChem CID 162885077) has the molecular formula C28H40O11 and a molecular weight of 552.62 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5R,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] butanoate.
| Compound Name | [(1R,2R,3S,4R,5R,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] butanoate |
|---|---|
| PubChem CID | 162885077 |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(1R,2R,3S,4R,5R,7S,8S,9R,12Z,14S,17R)-7,9-diacetyloxy-2,4-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C[C@H](OC(C)=O)[C@]2(C)[C@H](OC(C)=O)CC/C(C)=C\[C@@H]3OC(=O)[C@]4(C)O[C@]34[C@H](O)[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C28H40O11/c1-8-9-21(31)37-19-13-18(36-16(4)30)25(5)17(35-15(3)29)11-10-14(2)12-20-28(23(32)22(25)26(19,6)34)27(7,39-28)24(33)38-20/h12,17-20,22-23,32,34H,8-11,13H2,1-7H3/b14-12-/t17-,18+,19-,20+,22-,23-,25+,26+,27+,28+/m1/s1 |
| InChIKey | XRAQIRFEYCGELS-AAINSLGOSA-N |
| XLogP | 1.89 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|