C24H34O11 — CID 162860839
[(1R,2S,3S,4S,5S,7S,8S,9S,11R,12Z,14S,17R)-7-acetyloxy-2,4,5,11-tetrahydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate (PubChem CID 162860839) has the molecular formula C24H34O11 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5S,7S,8S,9S,11R,12Z,14S,17R)-7-acetyloxy-2,4,5,11-tetrahydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,5S,7S,8S,9S,11R,12Z,14S,17R)-7-acetyloxy-2,4,5,11-tetrahydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate |
|---|---|
| PubChem CID | 162860839 |
| Molecular Formula | C24H34O11 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [(1R,2S,3S,4S,5S,7S,8S,9S,11R,12Z,14S,17R)-7-acetyloxy-2,4,5,11-tetrahydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](O)/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@]23[C@@H](O)[C@H]2[C@](C)(O)[C@@H](O)C[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C24H34O11/c1-10-7-17-24(23(6,35-24)20(30)34-17)19(29)18-21(4,15(8-13(10)27)32-11(2)25)16(33-12(3)26)9-14(28)22(18,5)31/h7,13-19,27-29,31H,8-9H2,1-6H3/b10-7-/t13-,14+,15+,16+,17+,18-,19+,21+,22-,23+,24+/m1/s1 |
| InChIKey | NNHYGMYXMCHFDL-YNJQXFMKSA-N |
| XLogP | -0.49 |
| TPSA | 172.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|