C30H38O14 — CID 177469930
[(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10,11-tetraacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate (PubChem CID 177469930) has the molecular formula C30H38O14 and a molecular weight of 622.62 g/mol. Its IUPAC name is [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10,11-tetraacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate.
| Compound Name | [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10,11-tetraacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate |
|---|---|
| PubChem CID | 177469930 |
| Molecular Formula | C30H38O14 |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | [(1S,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,9,10,11-tetraacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate |
| SMILES | CC(=O)OC1/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@]23C(OC(C)=O)[C@H]2[C@](C)(O)[C@H](OC(C)=O)C=C[C@]2(C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H38O14/c1-13-12-20-30(29(9,44-30)26(36)43-20)25(42-18(6)35)23-27(7,11-10-19(28(23,8)37)38-14(2)31)24(41-17(5)34)22(40-16(4)33)21(13)39-15(3)32/h10-12,19-25,37H,1-9H3/b13-12-/t19-,20+,21?,22-,23-,24+,25?,27+,28-,29+,30+/m1/s1 |
| InChIKey | PTIRHELEGDAWPU-XXZARAAOSA-N |
| XLogP | 1.00 |
| TPSA | 190.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|