C28H38O13 — CID 10769589
[(1S,2R,3S,4S,7S,8Z,11R,12R,13S,16R,17S)-2,12,16-triacetyloxy-3,4,17-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate (PubChem CID 10769589) has the molecular formula C28H38O13 and a molecular weight of 582.60 g/mol. Its IUPAC name is [(1S,2R,3S,4S,7S,8Z,11R,12R,13S,16R,17S)-2,12,16-triacetyloxy-3,4,17-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate.
| Compound Name | [(1S,2R,3S,4S,7S,8Z,11R,12R,13S,16R,17S)-2,12,16-triacetyloxy-3,4,17-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate |
|---|---|
| PubChem CID | 10769589 |
| Molecular Formula | C28H38O13 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [(1S,2R,3S,4S,7S,8Z,11R,12R,13S,16R,17S)-2,12,16-triacetyloxy-3,4,17-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@](C)(O)[C@H](OC(C)=O)C=C[C@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C/C(C)=C\[C@@H]2OC(=O)[C@@](C)(O)[C@]21O |
| InChI | InChI=1S/C28H38O13/c1-13-11-18(37-14(2)29)22(39-16(4)31)25(6)10-9-19(38-15(3)30)26(7,34)21(25)23(40-17(5)32)28(36)20(12-13)41-24(33)27(28,8)35/h9-10,12,18-23,34-36H,11H2,1-8H3/b13-12-/t18-,19-,20+,21-,22+,23-,25+,26-,27-,28+/m1/s1 |
| InChIKey | WTAVEXXVQBMTGW-WLCSHWCWSA-N |
| XLogP | 0.41 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|