C26H34O11 — CID 162864361
[(1R,2R,3R,4S,5S,8R,9R,11S,12E,14R,17S)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] acetate (PubChem CID 162864361) has the molecular formula C26H34O11 and a molecular weight of 522.55 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5S,8R,9R,11S,12E,14R,17S)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] acetate.
| Compound Name | [(1R,2R,3R,4S,5S,8R,9R,11S,12E,14R,17S)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] acetate |
|---|---|
| PubChem CID | 162864361 |
| Molecular Formula | C26H34O11 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [(1R,2R,3R,4S,5S,8R,9R,11S,12E,14R,17S)-2,9-diacetyloxy-4,5-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC(C)=O)[C@]2(C)C=C[C@H](O)[C@@](C)(O)[C@H]2[C@@H](OC(C)=O)[C@@]23O[C@]2(C)C(=O)O[C@@H]3/C=C\1C |
| InChI | InChI=1S/C26H34O11/c1-12-10-19-26(25(7,37-26)22(31)36-19)21(35-15(4)29)20-23(5,9-8-17(30)24(20,6)32)18(34-14(3)28)11-16(12)33-13(2)27/h8-10,16-21,30,32H,11H2,1-7H3/b12-10-/t16-,17-,18+,19+,20-,21+,23-,24+,25+,26+/m0/s1 |
| InChIKey | PTFYRZVGQCRFOB-FNJZDQMASA-N |
| XLogP | 0.89 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|