C26H36O11 — CID 46830146
[(1S,2S,3S,4R,5S,7S,8R,9R,10S,12Z,14S,17S)-2,9-diacetyloxy-5,10-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate (PubChem CID 46830146) has the molecular formula C26H36O11 and a molecular weight of 524.56 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,7S,8R,9R,10S,12Z,14S,17S)-2,9-diacetyloxy-5,10-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,5S,7S,8R,9R,10S,12Z,14S,17S)-2,9-diacetyloxy-5,10-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate |
|---|---|
| PubChem CID | 46830146 |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | [(1S,2S,3S,4R,5S,7S,8R,9R,10S,12Z,14S,17S)-2,9-diacetyloxy-5,10-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@H](C)[C@@H]2[C@H](OC(C)=O)[C@]34O[C@]3(C)C(=O)O[C@H]4/C=C(/C)C[C@H](O)[C@H](OC(C)=O)[C@]21C |
| InChI | InChI=1S/C26H36O11/c1-11-8-17(31)21(34-14(4)28)24(6)18(33-13(3)27)10-16(30)12(2)20(24)22(35-15(5)29)26-19(9-11)36-23(32)25(26,7)37-26/h9,12,16-22,30-31H,8,10H2,1-7H3/b11-9-/t12-,16-,17-,18-,19-,20+,21-,22-,24-,25+,26-/m0/s1 |
| InChIKey | VUYMPAPPUKPGMS-LTSYTUNSSA-N |
| XLogP | 0.97 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|