C9H16Cl2 — CID 134889174
cis-(2S,3R)-1,1-dichloro-2,3-dipropylcyclopropane (PubChem CID 134889174) has the molecular formula C9H16Cl2 and a molecular weight of 195.13 g/mol. Its IUPAC name is cis-(2S,3R)-1,1-dichloro-2,3-dipropylcyclopropane.
| Compound Name | cis-(2S,3R)-1,1-dichloro-2,3-dipropylcyclopropane |
|---|---|
| PubChem CID | 134889174 |
| Molecular Formula | C9H16Cl2 |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | cis-(2S,3R)-1,1-dichloro-2,3-dipropylcyclopropane |
| SMILES | CCC[C@@H]1[C@H](CCC)C1(Cl)Cl |
| InChI | InChI=1S/C9H16Cl2/c1-3-5-7-8(6-4-2)9(7,10)11/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | PVQFLNLBKXZNKE-OCAPTIKFSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|