C9H17BrO2 — CID 97304593
(2R,3R)-2-(2-bromoethyl)-3-propyl-1,4-dioxane (PubChem CID 97304593) has the molecular formula C9H17BrO2 and a molecular weight of 237.14 g/mol. Its IUPAC name is (2R,3R)-2-(2-bromoethyl)-3-propyl-1,4-dioxane.
| Compound Name | (2R,3R)-2-(2-bromoethyl)-3-propyl-1,4-dioxane |
|---|---|
| PubChem CID | 97304593 |
| Molecular Formula | C9H17BrO2 |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2R,3R)-2-(2-bromoethyl)-3-propyl-1,4-dioxane |
| SMILES | CCC[C@H]1OCCO[C@@H]1CCBr |
| InChI | InChI=1S/C9H17BrO2/c1-2-3-8-9(4-5-10)12-7-6-11-8/h8-9H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | MDEKVJJRUARQTG-RKDXNWHRSA-N |
| XLogP | 2.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|