C11H24O — CID 156747522
(3R)-3,5-dimethyl-2-propyloxolane;ethane (PubChem CID 156747522) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is (3R)-3,5-dimethyl-2-propyloxolane;ethane.
| Compound Name | (3R)-3,5-dimethyl-2-propyloxolane;ethane |
|---|---|
| PubChem CID | 156747522 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | (3R)-3,5-dimethyl-2-propyloxolane;ethane |
| SMILES | CC.CCCC1OC(C)C[C@H]1C |
| InChI | InChI=1S/C9H18O.C2H6/c1-4-5-9-7(2)6-8(3)10-9;1-2/h7-9H,4-6H2,1-3H3;1-2H3/t7-,8?,9?;/m1./s1 |
| InChIKey | CCKXKESPEUHIBJ-CHHXHTNCSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |