C10H20O — CID 91467141
3,5-dimethyl-2-propyloxane (PubChem CID 91467141) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is 3,5-dimethyl-2-propyloxane.
| Compound Name | 3,5-dimethyl-2-propyloxane |
|---|---|
| PubChem CID | 91467141 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 3,5-dimethyl-2-propyloxane |
| SMILES | CCCC1OCC(C)CC1C |
| InChI | InChI=1S/C10H20O/c1-4-5-10-9(3)6-8(2)7-11-10/h8-10H,4-7H2,1-3H3 |
| InChIKey | OIJZSZKWHZYHFE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |