About 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane
3-propyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 23172287) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
| PubChem CID | 23172287 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCC1OC2OCC1CO2 |
| InChI | InChI=1S/C8H14O3/c1-2-3-7-6-4-9-8(11-7)10-5-6/h6-8H,2-5H2,1H3 |
| InChIKey | XDRAZBUIYGKPRA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane?
The IUPAC name of 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane (CID 23172287) is 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane.
What is the SMILES notation for 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane?
The canonical SMILES for 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane is CCCC1OC2OCC1CO2.
What is the InChIKey of 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane?
The InChIKey is XDRAZBUIYGKPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-3-7-6-4-9-8(11-7)10-5-6/h6-8H,2-5H2,1H3.
What are the key properties of 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane?
3-propyl-2,6,7-trioxabicyclo[2.2.2]octane has a molecular weight of 158.20 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-2,6,7-trioxabicyclo[2.2.2]octane is sourced from PubChem (CID 23172287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).