C12H22O2 — CID 137382626
(6aR)-3,6-dipropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 137382626) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (6aR)-3,6-dipropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (6aR)-3,6-dipropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 137382626 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (6aR)-3,6-dipropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCCC1CO[C@@H]2C(CCC)COC12 |
| InChI | InChI=1S/C12H22O2/c1-3-5-9-7-13-12-10(6-4-2)8-14-11(9)12/h9-12H,3-8H2,1-2H3/t9?,10?,11-,12?/m1/s1 |
| InChIKey | KKTYJWAYNODLCM-QDLLBCNESA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |