About ethane;methane;3-methyl-4-propyloxolane
ethane;methane;3-methyl-4-propyloxolane (PubChem CID 144611295) has the molecular formula C11H26O
and a molecular weight of 174.33 g/mol. Its IUPAC name is ethane;methane;3-methyl-4-propyloxolane.
Molecular Properties
| Compound Name | ethane;methane;3-methyl-4-propyloxolane |
| PubChem CID | 144611295 |
| Molecular Formula | C11H26O |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.20 |
| IUPAC Name | ethane;methane;3-methyl-4-propyloxolane |
| SMILES | C.CC.CCCC1COCC1C |
| InChI | InChI=1S/C8H16O.C2H6.CH4/c1-3-4-8-6-9-5-7(8)2;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H4 |
| InChIKey | CTVSSFMKCCRGNP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methane;3-methyl-4-propyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-methyl-4-propyloxolane?
The IUPAC name of ethane;methane;3-methyl-4-propyloxolane (CID 144611295) is ethane;methane;3-methyl-4-propyloxolane.
What is the SMILES notation for ethane;methane;3-methyl-4-propyloxolane?
The canonical SMILES for ethane;methane;3-methyl-4-propyloxolane is C.CC.CCCC1COCC1C.
What is the InChIKey of ethane;methane;3-methyl-4-propyloxolane?
The InChIKey is CTVSSFMKCCRGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C2H6.CH4/c1-3-4-8-6-9-5-7(8)2;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;3-methyl-4-propyloxolane?
ethane;methane;3-methyl-4-propyloxolane has a molecular weight of 174.33 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-methyl-4-propyloxolane is sourced from PubChem (CID 144611295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).