C14H32 — CID 155717345
1,4-dimethyl-2-propylcyclopentane;ethane (PubChem CID 155717345) has the molecular formula C14H32 and a molecular weight of 200.41 g/mol. Its IUPAC name is 1,4-dimethyl-2-propylcyclopentane;ethane.
| Compound Name | 1,4-dimethyl-2-propylcyclopentane;ethane |
|---|---|
| PubChem CID | 155717345 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | 1,4-dimethyl-2-propylcyclopentane;ethane |
| SMILES | CC.CC.CCCC1CC(C)CC1C |
| InChI | InChI=1S/C10H20.2C2H6/c1-4-5-10-7-8(2)6-9(10)3;2*1-2/h8-10H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | DCTFNXCEEDALDM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |