C14H30 — CID 156835083
ethane;1,2,4-trimethyl-5-propylcyclohexane (PubChem CID 156835083) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is ethane;1,2,4-trimethyl-5-propylcyclohexane.
| Compound Name | ethane;1,2,4-trimethyl-5-propylcyclohexane |
|---|---|
| PubChem CID | 156835083 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | ethane;1,2,4-trimethyl-5-propylcyclohexane |
| SMILES | CC.CCCC1CC(C)C(C)CC1C |
| InChI | InChI=1S/C12H24.C2H6/c1-5-6-12-8-10(3)9(2)7-11(12)4;1-2/h9-12H,5-8H2,1-4H3;1-2H3 |
| InChIKey | DTMSRWJPULGXBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |