C16H30 — CID 123584713
1,5-dimethyl-2-(3-methylbut-3-enyl)-4-propylcyclohexane (PubChem CID 123584713) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 1,5-dimethyl-2-(3-methylbut-3-enyl)-4-propylcyclohexane.
| Compound Name | 1,5-dimethyl-2-(3-methylbut-3-enyl)-4-propylcyclohexane |
|---|---|
| PubChem CID | 123584713 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 1,5-dimethyl-2-(3-methylbut-3-enyl)-4-propylcyclohexane |
| SMILES | C=C(C)CCC1CC(CCC)C(C)CC1C |
| InChI | InChI=1S/C16H30/c1-6-7-15-11-16(9-8-12(2)3)14(5)10-13(15)4/h13-16H,2,6-11H2,1,3-5H3 |
| InChIKey | KNSPVUQRHBWVPE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|