C12H22O — CID 114476472
4-methyl-2-(3-methylbut-3-enyl)cyclohexan-1-ol (PubChem CID 114476472) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-methyl-2-(3-methylbut-3-enyl)cyclohexan-1-ol.
| Compound Name | 4-methyl-2-(3-methylbut-3-enyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114476472 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 4-methyl-2-(3-methylbut-3-enyl)cyclohexan-1-ol |
| SMILES | C=C(C)CCC1CC(C)CCC1O |
| InChI | InChI=1S/C12H22O/c1-9(2)4-6-11-8-10(3)5-7-12(11)13/h10-13H,1,4-8H2,2-3H3 |
| InChIKey | SSDBERKXIHKDQL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|