C23H27Cl2NO2 — CID 91330613
3,4-dichloro-N-[4-[(5-methyl-6-propyloxan-3-yl)methyl]phenyl]benzamide (PubChem CID 91330613) has the molecular formula C23H27Cl2NO2 and a molecular weight of 420.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[(5-methyl-6-propyloxan-3-yl)methyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[(5-methyl-6-propyloxan-3-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 91330613 |
| Molecular Formula | C23H27Cl2NO2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3,4-dichloro-N-[4-[(5-methyl-6-propyloxan-3-yl)methyl]phenyl]benzamide |
| SMILES | CCCC1OCC(Cc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)CC1C |
| InChI | InChI=1S/C23H27Cl2NO2/c1-3-4-22-15(2)11-17(14-28-22)12-16-5-8-19(9-6-16)26-23(27)18-7-10-20(24)21(25)13-18/h5-10,13,15,17,22H,3-4,11-12,14H2,1-2H3,(H,26,27) |
| InChIKey | WYDUKJVQAAULFP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |