C21H23Cl2NOS — CID 91546809
3,4-dichloro-N-[4-[(5,6-dimethylthian-3-yl)methyl]phenyl]benzamide (PubChem CID 91546809) has the molecular formula C21H23Cl2NOS and a molecular weight of 408.39 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[(5,6-dimethylthian-3-yl)methyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[(5,6-dimethylthian-3-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 91546809 |
| Molecular Formula | C21H23Cl2NOS |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3,4-dichloro-N-[4-[(5,6-dimethylthian-3-yl)methyl]phenyl]benzamide |
| SMILES | CC1CC(Cc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)CSC1C |
| InChI | InChI=1S/C21H23Cl2NOS/c1-13-9-16(12-26-14(13)2)10-15-3-6-18(7-4-15)24-21(25)17-5-8-19(22)20(23)11-17/h3-8,11,13-14,16H,9-10,12H2,1-2H3,(H,24,25) |
| InChIKey | SNQRDVUUCAYURK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |