C19H21Cl3N2O — CID 25269154
3,4-dichloro-N-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]benzamide chloride (PubChem CID 25269154) has the molecular formula C19H21Cl3N2O and a molecular weight of 399.75 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]benzamide chloride.
| Compound Name | 3,4-dichloro-N-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]benzamide chloride |
|---|---|
| PubChem CID | 25269154 |
| Molecular Formula | C19H21Cl3N2O |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3,4-dichloro-N-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]benzamide chloride |
| SMILES | C[N+]1(Cc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)CCCC1.[Cl-] |
| InChI | InChI=1S/C19H20Cl2N2O.ClH/c1-23(10-2-3-11-23)13-14-4-7-16(8-5-14)22-19(24)15-6-9-17(20)18(21)12-15;/h4-9,12H,2-3,10-11,13H2,1H3;1H |
| InChIKey | ZFAIVMNSRCYBTR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|