C20H21Cl2N2O2+ — CID 118928864
[4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl-methylidene-[[(2S)-oxolan-2-yl]methyl]azanium (PubChem CID 118928864) has the molecular formula C20H21Cl2N2O2+ and a molecular weight of 392.31 g/mol. Its IUPAC name is [4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl-methylidene-[[(2S)-oxolan-2-yl]methyl]azanium.
| Compound Name | [4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl-methylidene-[[(2S)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 118928864 |
| Molecular Formula | C20H21Cl2N2O2+ |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl-methylidene-[[(2S)-oxolan-2-yl]methyl]azanium |
| SMILES | C=[N+](Cc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c1-24(13-17-3-2-10-26-17)12-14-4-7-16(8-5-14)23-20(25)15-6-9-18(21)19(22)11-15/h4-9,11,17H,1-3,10,12-13H2/p+1/t17-/m0/s1 |
| InChIKey | VRJPPSOWLYMBSB-KRWDZBQOSA-O |
| XLogP | 4.64 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|