C22H28ClIN2O2 — CID 118914131
[4-[(3-chloro-4-methylbenzoyl)amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium iodide (PubChem CID 118914131) has the molecular formula C22H28ClIN2O2 and a molecular weight of 514.84 g/mol. Its IUPAC name is [4-[(3-chloro-4-methylbenzoyl)amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium iodide.
| Compound Name | [4-[(3-chloro-4-methylbenzoyl)amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium iodide |
|---|---|
| PubChem CID | 118914131 |
| Molecular Formula | C22H28ClIN2O2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | [4-[(3-chloro-4-methylbenzoyl)amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium iodide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C[N+](C)(C)C3CCOCC3)cc2)cc1Cl.[I-] |
| InChI | InChI=1S/C22H27ClN2O2.HI/c1-16-4-7-18(14-21(16)23)22(26)24-19-8-5-17(6-9-19)15-25(2,3)20-10-12-27-13-11-20;/h4-9,14,20H,10-13,15H2,1-3H3;1H |
| InChIKey | AEYSLGUODUDGMK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|