C28H33IN2O2 — CID 118914134
dimethyl-[[4-[[3-(4-methylphenyl)benzoyl]amino]phenyl]methyl]-(oxan-4-yl)azanium iodide (PubChem CID 118914134) has the molecular formula C28H33IN2O2 and a molecular weight of 556.49 g/mol. Its IUPAC name is dimethyl-[[4-[[3-(4-methylphenyl)benzoyl]amino]phenyl]methyl]-(oxan-4-yl)azanium iodide.
| Compound Name | dimethyl-[[4-[[3-(4-methylphenyl)benzoyl]amino]phenyl]methyl]-(oxan-4-yl)azanium iodide |
|---|---|
| PubChem CID | 118914134 |
| Molecular Formula | C28H33IN2O2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | dimethyl-[[4-[[3-(4-methylphenyl)benzoyl]amino]phenyl]methyl]-(oxan-4-yl)azanium iodide |
| SMILES | Cc1ccc(-c2cccc(C(=O)Nc3ccc(C[N+](C)(C)C4CCOCC4)cc3)c2)cc1.[I-] |
| InChI | InChI=1S/C28H32N2O2.HI/c1-21-7-11-23(12-8-21)24-5-4-6-25(19-24)28(31)29-26-13-9-22(10-14-26)20-30(2,3)27-15-17-32-18-16-27;/h4-14,19,27H,15-18,20H2,1-3H3;1H |
| InChIKey | QXIJHMXGYOGOTH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|