C23H28N3O3S+ — CID 71586710
dimethyl-[[4-[(1-methyl-3-oxo-2,1-benzothiazole-5-carbonyl)amino]phenyl]methyl]-(oxan-4-yl)azanium (PubChem CID 71586710) has the molecular formula C23H28N3O3S+ and a molecular weight of 426.56 g/mol. Its IUPAC name is dimethyl-[[4-[(1-methyl-3-oxo-2,1-benzothiazole-5-carbonyl)amino]phenyl]methyl]-(oxan-4-yl)azanium.
| Compound Name | dimethyl-[[4-[(1-methyl-3-oxo-2,1-benzothiazole-5-carbonyl)amino]phenyl]methyl]-(oxan-4-yl)azanium |
|---|---|
| PubChem CID | 71586710 |
| Molecular Formula | C23H28N3O3S+ |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | dimethyl-[[4-[(1-methyl-3-oxo-2,1-benzothiazole-5-carbonyl)amino]phenyl]methyl]-(oxan-4-yl)azanium |
| SMILES | Cn1sc(=O)c2cc(C(=O)Nc3ccc(C[N+](C)(C)C4CCOCC4)cc3)ccc21 |
| InChI | InChI=1S/C23H27N3O3S/c1-25-21-9-6-17(14-20(21)23(28)30-25)22(27)24-18-7-4-16(5-8-18)15-26(2,3)19-10-12-29-13-11-19/h4-9,14,19H,10-13,15H2,1-3H3/p+1 |
| InChIKey | NYTFJHSHTROIFB-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|