C23H27F2N2O2+ — CID 42632890
[4-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium (PubChem CID 42632890) has the molecular formula C23H27F2N2O2+ and a molecular weight of 401.48 g/mol. Its IUPAC name is [4-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium.
| Compound Name | [4-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
|---|---|
| PubChem CID | 42632890 |
| Molecular Formula | C23H27F2N2O2+ |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [4-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)/C=C/c2cc(F)cc(F)c2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C23H26F2N2O2/c1-27(2,22-9-11-29-12-10-22)16-17-3-6-21(7-4-17)26-23(28)8-5-18-13-19(24)15-20(25)14-18/h3-8,13-15,22H,9-12,16H2,1-2H3/p+1/b8-5+ |
| InChIKey | PBLCTBFBELHHPJ-VMPITWQZSA-O |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|