C25H32BrClN2O — CID 74439782
[4-[[3-(3-bromophenyl)prop-2-enoylamino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium chloride (PubChem CID 74439782) has the molecular formula C25H32BrClN2O and a molecular weight of 491.90 g/mol. Its IUPAC name is [4-[[3-(3-bromophenyl)prop-2-enoylamino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium chloride.
| Compound Name | [4-[[3-(3-bromophenyl)prop-2-enoylamino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 74439782 |
| Molecular Formula | C25H32BrClN2O |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [4-[[3-(3-bromophenyl)prop-2-enoylamino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium chloride |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)C=Cc2cccc(Br)c2)cc1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C25H31BrN2O.ClH/c1-28(2,24-9-4-3-5-10-24)19-22-13-11-21(12-14-22)18-27-25(29)16-15-20-7-6-8-23(26)17-20;/h6-8,11-17,24H,3-5,9-10,18-19H2,1-2H3;1H |
| InChIKey | QJQWAGSMBTVPBU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|