C23H30BrN2O+ — CID 25267734
[4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium (PubChem CID 25267734) has the molecular formula C23H30BrN2O+ and a molecular weight of 430.41 g/mol. Its IUPAC name is [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium.
| Compound Name | [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium |
|---|---|
| PubChem CID | 25267734 |
| Molecular Formula | C23H30BrN2O+ |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)c2cccc(Br)c2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H29BrN2O/c1-26(2,22-9-4-3-5-10-22)17-19-13-11-18(12-14-19)16-25-23(27)20-7-6-8-21(24)15-20/h6-8,11-15,22H,3-5,9-10,16-17H2,1-2H3/p+1 |
| InChIKey | DMYJQJYFXZTBNA-UHFFFAOYSA-O |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|