C16H21BrN2O2 — CID 51210719
3-bromo-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]benzamide (PubChem CID 51210719) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 3-bromo-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 51210719 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-bromo-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]benzamide |
| SMILES | CN(C(=O)CNC(=O)c1cccc(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H21BrN2O2/c1-19(14-8-3-2-4-9-14)15(20)11-18-16(21)12-6-5-7-13(17)10-12/h5-7,10,14H,2-4,8-9,11H2,1H3,(H,18,21) |
| InChIKey | WPYDYFUMUQYCKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |