C26H32BrN3O2 — CID 46156224
2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-cyclohexyl-N-methylbenzamide (PubChem CID 46156224) has the molecular formula C26H32BrN3O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 46156224 |
| Molecular Formula | C26H32BrN3O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-cyclohexyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1N1CCC(NC(=O)c2cccc(Br)c2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C26H32BrN3O2/c1-29(22-10-3-2-4-11-22)26(32)23-12-5-6-13-24(23)30-16-14-21(15-17-30)28-25(31)19-8-7-9-20(27)18-19/h5-9,12-13,18,21-22H,2-4,10-11,14-17H2,1H3,(H,28,31) |
| InChIKey | PJZICIZYUSZGCY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |